C11H14O — CID 98162235
(2R,3R,6R,7R)-4-ethoxypentacyclo[4.3.0.02,5.03,8.04,7]nonane (PubChem CID 98162235) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is (2R,3R,6R,7R)-4-ethoxypentacyclo[4.3.0.02,5.03,8.04,7]nonane.
| Compound Name | (2R,3R,6R,7R)-4-ethoxypentacyclo[4.3.0.02,5.03,8.04,7]nonane |
|---|---|
| PubChem CID | 98162235 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (2R,3R,6R,7R)-4-ethoxypentacyclo[4.3.0.02,5.03,8.04,7]nonane |
| SMILES | CCOC12C3[C@@H]4C5CC([C@H]41)[C@@H]2[C@@H]53 |
| InChI | InChI=1S/C11H14O/c1-2-12-11-8-5-3-4-6(8)10(11)7(4)9(5)11/h4-10H,2-3H2,1H3/t4?,5?,6-,7-,8-,9-,10?,11?/m1/s1 |
| InChIKey | VTEAFGTZEXYUBS-KVCJFUTRSA-N |
| XLogP | 1.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |