C18H28O2 — CID 42602354
(1R,2R,4S,6R,7S,9S,11R,12S)-1,2-diethoxypentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 42602354) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (1R,2R,4S,6R,7S,9S,11R,12S)-1,2-diethoxypentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | (1R,2R,4S,6R,7S,9S,11R,12S)-1,2-diethoxypentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 42602354 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (1R,2R,4S,6R,7S,9S,11R,12S)-1,2-diethoxypentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | CCO[C@]12C[C@H]3C[C@@H]4[C@H]5C[C@@H](C[C@@H]41)C[C@@]2(OCC)[C@H]5C3 |
| InChI | InChI=1S/C18H28O2/c1-3-19-17-9-11-5-13-14-6-12(7-15(13)17)10-18(17,20-4-2)16(14)8-11/h11-16H,3-10H2,1-2H3/t11-,12-,13+,14+,15-,16-,17+,18+/m0/s1 |
| InChIKey | FROSOZGSWAQSFV-WUDMRHBMSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |