About 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane
1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 13046553) has the molecular formula C14H19F
and a molecular weight of 206.30 g/mol. Its IUPAC name is 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
Analyze 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The IUPAC name of 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (CID 13046553) is 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
What is the SMILES notation for 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The canonical SMILES for 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is FC12CC3CC4C5CC(CC41)CC2C5C3.
What is the InChIKey of 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
The InChIKey is PUFSXTIJGWPRGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F/c15-14-6-8-2-10-9-1-7(4-12(10)14)5-13(14)11(9)3-8/h7-13H,1-6H2.
What are the key properties of 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane?
1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane has a molecular weight of 206.30 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoropentacyclo[7.3.1.14,12.02,7.06,11]tetradecane is sourced from PubChem (CID 13046553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).