About hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane
hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane (PubChem CID 58460580) has the molecular formula C15H20
and a molecular weight of 200.32 g/mol. Its IUPAC name is hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane.
Analyze hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane?
The IUPAC name of hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane (CID 58460580) is hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane.
What is the SMILES notation for hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane?
The canonical SMILES for hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane is C1C2CC34CC5(C2)C2CC(CC3C12)CC45.
What is the InChIKey of hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane?
The InChIKey is ARLNMRAEJRKGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20/c1-9-5-14-7-15(6-9)12-3-8(4-13(14)15)2-11(14)10(1)12/h8-13H,1-7H2.
What are the key properties of hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane?
hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane has a molecular weight of 200.32 g/mol, XLogP of 3.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexacyclo[6.4.2.13,11.01,6.05,10.011,13]pentadecane is sourced from PubChem (CID 58460580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).