C15H24 — CID 20680012
6',6'-dimethyl-2,2'-spirobi[bicyclo[2.2.1]heptane] (PubChem CID 20680012) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 6',6'-dimethyl-2,2'-spirobi[bicyclo[2.2.1]heptane].
| Compound Name | 6',6'-dimethyl-2,2'-spirobi[bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 20680012 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 6',6'-dimethyl-2,2'-spirobi[bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)CC2CC1C1(CC3CCC1C3)C2 |
| InChI | InChI=1S/C15H24/c1-14(2)7-11-6-13(14)15(9-11)8-10-3-4-12(15)5-10/h10-13H,3-9H2,1-2H3 |
| InChIKey | VTEZBOJKTURVRF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |