About 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]
4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine] (PubChem CID 20705204) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine].
Analyze 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]?
The IUPAC name of 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine] (CID 20705204) is 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine].
What is the SMILES notation for 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]?
The canonical SMILES for 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine] is CC1CNCC12CC1CCC2C1.
What is the InChIKey of 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]?
The InChIKey is OPWMEGUFASIBAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-8-6-12-7-11(8)5-9-2-3-10(11)4-9/h8-10,12H,2-7H2,1H3.
What are the key properties of 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine]?
4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine] has a molecular weight of 165.28 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-methylspiro[bicyclo[2.2.1]heptane-2,3'-pyrrolidine] is sourced from PubChem (CID 20705204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).