C9H19N3 — CID 123899490
4,9-dimethyl-2,7-diazaspiro[4.4]nonan-2-amine (PubChem CID 123899490) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 4,9-dimethyl-2,7-diazaspiro[4.4]nonan-2-amine.
| Compound Name | 4,9-dimethyl-2,7-diazaspiro[4.4]nonan-2-amine |
|---|---|
| PubChem CID | 123899490 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 4,9-dimethyl-2,7-diazaspiro[4.4]nonan-2-amine |
| SMILES | CC1CNCC12CN(N)CC2C |
| InChI | InChI=1S/C9H19N3/c1-7-3-11-5-9(7)6-12(10)4-8(9)2/h7-8,11H,3-6,10H2,1-2H3 |
| InChIKey | QMGQEHWHNXLQFX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|