C8H17N — CID 130186897
(3R,4S)-3-ethyl-3,4-dimethylpyrrolidine (PubChem CID 130186897) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-3,4-dimethylpyrrolidine.
| Compound Name | (3R,4S)-3-ethyl-3,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 130186897 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (3R,4S)-3-ethyl-3,4-dimethylpyrrolidine |
| SMILES | CC[C@@]1(C)CNC[C@H]1C |
| InChI | InChI=1S/C8H17N/c1-4-8(3)6-9-5-7(8)2/h7,9H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | NIVVLHGWZYWBET-SFYZADRCSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |