About (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine
(3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine (PubChem CID 118444596) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine |
| PubChem CID | 118444596 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine |
| SMILES | CC(C)[C@]1(C)CNC[C@H]1C |
| InChI | InChI=1S/C9H19N/c1-7(2)9(4)6-10-5-8(9)3/h7-8,10H,5-6H2,1-4H3/t8-,9+/m1/s1 |
| InChIKey | IHLDTXITVLLEAM-BDAKNGLRSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine?
The IUPAC name of (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine (CID 118444596) is (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine.
What is the SMILES notation for (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine?
The canonical SMILES for (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine is CC(C)[C@]1(C)CNC[C@H]1C.
What is the InChIKey of (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine?
The InChIKey is IHLDTXITVLLEAM-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H19N/c1-7(2)9(4)6-10-5-8(9)3/h7-8,10H,5-6H2,1-4H3/t8-,9+/m1/s1.
What are the key properties of (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine?
(3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine has a molecular weight of 141.26 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3,4-dimethyl-3-propan-2-ylpyrrolidine is sourced from PubChem (CID 118444596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).