molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane

C8H17N — CID 144912446

IUPACmolecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane
SMILESCC(C)C12CNCC1C2.[H][H]
InChIInChI=1S/C8H15N.H2/c1-6(2)8-3-7(8)4-9-5-8;/h6-7,9H,3-5H2,1-2H3;1H
InChIKeySUIBVOSEBWQDHR-UHFFFAOYSA-N
MW127.23 g/mol
LogP1.50
Rot. Bonds1

About molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane

molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 144912446) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane.

Molecular Properties

Compound Namemolecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane
PubChem CID144912446
Molecular FormulaC8H17N
Molecular Weight127.23 g/mol
Exact Mass127.14
IUPAC Namemolecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane
SMILESCC(C)C12CNCC1C2.[H][H]
InChIInChI=1S/C8H15N.H2/c1-6(2)8-3-7(8)4-9-5-8;/h6-7,9H,3-5H2,1-2H3;1H
InChIKeySUIBVOSEBWQDHR-UHFFFAOYSA-N
XLogP1.50
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.23
LogP ≤ 51.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The IUPAC name of molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane (CID 144912446) is molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane is CC(C)C12CNCC1C2.[H][H].
What is the InChIKey of molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane?
The InChIKey is SUIBVOSEBWQDHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.H2/c1-6(2)8-3-7(8)4-9-5-8;/h6-7,9H,3-5H2,1-2H3;1H.
What are the key properties of molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane?
molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane has a molecular weight of 127.23 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1-propan-2-yl-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 144912446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).