C7H14N2 — CID 171036424
(1R)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-1-amine (PubChem CID 171036424) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-1-amine.
| Compound Name | (1R)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-1-amine |
|---|---|
| PubChem CID | 171036424 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (1R)-N,N-dimethyl-3-azabicyclo[3.1.0]hexan-1-amine |
| SMILES | CN(C)[C@@]12CNCC1C2 |
| InChI | InChI=1S/C7H14N2/c1-9(2)7-3-6(7)4-8-5-7/h6,8H,3-5H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | AZUHFCOQWFMZEW-MLWJPKLSSA-N |
| XLogP | -0.09 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |