C13H16ClN2O2- — CID 129317751
N-(3-azabicyclo[3.1.0]hexan-1-yl)-N-benzylcarbamate;hydrochloride (PubChem CID 129317751) has the molecular formula C13H16ClN2O2- and a molecular weight of 267.74 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-1-yl)-N-benzylcarbamate;hydrochloride.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-1-yl)-N-benzylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 129317751 |
| Molecular Formula | C13H16ClN2O2- |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-1-yl)-N-benzylcarbamate;hydrochloride |
| SMILES | Cl.O=C([O-])N(Cc1ccccc1)C12CNCC1C2 |
| InChI | InChI=1S/C13H16N2O2.ClH/c16-12(17)15(8-10-4-2-1-3-5-10)13-6-11(13)7-14-9-13;/h1-5,11,14H,6-9H2,(H,16,17);1H/p-1 |
| InChIKey | AZTVNIURQFYOBN-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |