C8H18F2N2 — CID 177136763
3a-fluoro-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;hydrofluoride (PubChem CID 177136763) has the molecular formula C8H18F2N2 and a molecular weight of 180.24 g/mol. Its IUPAC name is 3a-fluoro-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;hydrofluoride.
| Compound Name | 3a-fluoro-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;hydrofluoride |
|---|---|
| PubChem CID | 177136763 |
| Molecular Formula | C8H18F2N2 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3a-fluoro-2,3,4,5,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;hydrofluoride |
| SMILES | CC.F.FC12CNCC1CNC2 |
| InChI | InChI=1S/C6H11FN2.C2H6.FH/c7-6-3-8-1-5(6)2-9-4-6;1-2;/h5,8-9H,1-4H2;1-2H3;1H |
| InChIKey | MRGOXXIWGXMAQK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |