C4H9ClF2N2 — CID 170923039
(3R)-4,4-difluoropyrrolidin-3-amine;hydrochloride (PubChem CID 170923039) has the molecular formula C4H9ClF2N2 and a molecular weight of 158.58 g/mol. Its IUPAC name is (3R)-4,4-difluoropyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-4,4-difluoropyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 170923039 |
| Molecular Formula | C4H9ClF2N2 |
| Molecular Weight | 158.58 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | (3R)-4,4-difluoropyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CNCC1(F)F |
| InChI | InChI=1S/C4H8F2N2.ClH/c5-4(6)2-8-1-3(4)7;/h3,8H,1-2,7H2;1H/t3-;/m1./s1 |
| InChIKey | OHVRUSXHQUQQGV-AENDTGMFSA-N |
| XLogP | -0.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.58 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |