C5H11ClF2N2 — CID 121487885
4,4-difluoropiperidin-3-amine;hydrochloride (PubChem CID 121487885) has the molecular formula C5H11ClF2N2 and a molecular weight of 172.61 g/mol. Its IUPAC name is 4,4-difluoropiperidin-3-amine;hydrochloride.
| Compound Name | 4,4-difluoropiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 121487885 |
| Molecular Formula | C5H11ClF2N2 |
| Molecular Weight | 172.61 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 4,4-difluoropiperidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CNCCC1(F)F |
| InChI | InChI=1S/C5H10F2N2.ClH/c6-5(7)1-2-9-3-4(5)8;/h4,9H,1-3,8H2;1H |
| InChIKey | OHLZFYZQRZYNDN-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.61 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |