C10H18F2N2O — CID 105475528
4-[(4,4-difluoropiperidin-3-yl)methyl]morpholine (PubChem CID 105475528) has the molecular formula C10H18F2N2O and a molecular weight of 220.26 g/mol. Its IUPAC name is 4-[(4,4-difluoropiperidin-3-yl)methyl]morpholine.
| Compound Name | 4-[(4,4-difluoropiperidin-3-yl)methyl]morpholine |
|---|---|
| PubChem CID | 105475528 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4-[(4,4-difluoropiperidin-3-yl)methyl]morpholine |
| SMILES | FC1(F)CCNCC1CN1CCOCC1 |
| InChI | InChI=1S/C10H18F2N2O/c11-10(12)1-2-13-7-9(10)8-14-3-5-15-6-4-14/h9,13H,1-8H2 |
| InChIKey | FBHGQGAHZPTDHI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |