About molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride
molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride (PubChem CID 157031643) has the molecular formula C8H17F
and a molecular weight of 132.22 g/mol. Its IUPAC name is molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride.
Molecular Properties
| Compound Name | molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride |
| PubChem CID | 157031643 |
| Molecular Formula | C8H17F |
| Molecular Weight | 132.22 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride |
| SMILES | CC(C)[C@@]12CCC1C2.F.[H][H] |
| InChI | InChI=1S/C8H14.FH.H2/c1-6(2)8-4-3-7(8)5-8;;/h6-7H,3-5H2,1-2H3;2*1H/t7?,8-;;/m0../s1 |
| InChIKey | CLIORJUSTCIYMC-AEUOCKLGSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride?
The IUPAC name of molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride (CID 157031643) is molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride.
What is the SMILES notation for molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride?
The canonical SMILES for molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride is CC(C)[C@@]12CCC1C2.F.[H][H].
What is the InChIKey of molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride?
The InChIKey is CLIORJUSTCIYMC-AEUOCKLGSA-N. The full InChI is InChI=1S/C8H14.FH.H2/c1-6(2)8-4-3-7(8)5-8;;/h6-7H,3-5H2,1-2H3;2*1H/t7?,8-;;/m0../s1.
What are the key properties of molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride?
molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride has a molecular weight of 132.22 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;(1S)-1-propan-2-ylbicyclo[2.1.0]pentane;hydrofluoride is sourced from PubChem (CID 157031643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).