C9H14F2 — CID 171796329
(1S)-3,3-difluoro-1-propan-2-ylbicyclo[3.1.0]hexane (PubChem CID 171796329) has the molecular formula C9H14F2 and a molecular weight of 160.21 g/mol. Its IUPAC name is (1S)-3,3-difluoro-1-propan-2-ylbicyclo[3.1.0]hexane.
| Compound Name | (1S)-3,3-difluoro-1-propan-2-ylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 171796329 |
| Molecular Formula | C9H14F2 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (1S)-3,3-difluoro-1-propan-2-ylbicyclo[3.1.0]hexane |
| SMILES | CC(C)[C@@]12CC1CC(F)(F)C2 |
| InChI | InChI=1S/C9H14F2/c1-6(2)8-3-7(8)4-9(10,11)5-8/h6-7H,3-5H2,1-2H3/t7?,8-/m0/s1 |
| InChIKey | JLZKSWUAOJGVRE-MQWKRIRWSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |