C18H37N — CID 174319212
3,3,5,7,9,9-hexamethyl-6-propan-2-ylazecane (PubChem CID 174319212) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is 3,3,5,7,9,9-hexamethyl-6-propan-2-ylazecane.
| Compound Name | 3,3,5,7,9,9-hexamethyl-6-propan-2-ylazecane |
|---|---|
| PubChem CID | 174319212 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | 3,3,5,7,9,9-hexamethyl-6-propan-2-ylazecane |
| SMILES | CC(C)C1C(C)CC(C)(C)CNCC(C)(C)CC1C |
| InChI | InChI=1S/C18H37N/c1-13(2)16-14(3)9-17(5,6)11-19-12-18(7,8)10-15(16)4/h13-16,19H,9-12H2,1-8H3 |
| InChIKey | BGNNGIPHDSDDMK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |