C8H18N2 — CID 123426306
6,6-dimethylazepan-4-amine (PubChem CID 123426306) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 6,6-dimethylazepan-4-amine.
| Compound Name | 6,6-dimethylazepan-4-amine |
|---|---|
| PubChem CID | 123426306 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 6,6-dimethylazepan-4-amine |
| SMILES | CC1(C)CNCCC(N)C1 |
| InChI | InChI=1S/C8H18N2/c1-8(2)5-7(9)3-4-10-6-8/h7,10H,3-6,9H2,1-2H3 |
| InChIKey | ZVQPQPUAWLLZKL-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |