C8H16N2 — CID 97168804
(5R,8S)-2-azaspiro[4.4]nonan-8-amine (PubChem CID 97168804) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (5R,8S)-2-azaspiro[4.4]nonan-8-amine.
| Compound Name | (5R,8S)-2-azaspiro[4.4]nonan-8-amine |
|---|---|
| PubChem CID | 97168804 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (5R,8S)-2-azaspiro[4.4]nonan-8-amine |
| SMILES | N[C@H]1CC[C@@]2(CCNC2)C1 |
| InChI | InChI=1S/C8H16N2/c9-7-1-2-8(5-7)3-4-10-6-8/h7,10H,1-6,9H2/t7-,8+/m0/s1 |
| InChIKey | YHRURJWIJPNSTG-JGVFFNPUSA-N |
| XLogP | 0.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |