About 3,3-dimethylpyrrolidine;hydroiodide
3,3-dimethylpyrrolidine;hydroiodide (PubChem CID 173023387) has the molecular formula C6H14IN
and a molecular weight of 227.09 g/mol. Its IUPAC name is 3,3-dimethylpyrrolidine;hydroiodide.
Molecular Properties
| Compound Name | 3,3-dimethylpyrrolidine;hydroiodide |
| PubChem CID | 173023387 |
| Molecular Formula | C6H14IN |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 3,3-dimethylpyrrolidine;hydroiodide |
| SMILES | CC1(C)CCNC1.I |
| InChI | InChI=1S/C6H13N.HI/c1-6(2)3-4-7-5-6;/h7H,3-5H2,1-2H3;1H |
| InChIKey | AHVGGTZSILSNBZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylpyrrolidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpyrrolidine;hydroiodide?
The IUPAC name of 3,3-dimethylpyrrolidine;hydroiodide (CID 173023387) is 3,3-dimethylpyrrolidine;hydroiodide.
What is the SMILES notation for 3,3-dimethylpyrrolidine;hydroiodide?
The canonical SMILES for 3,3-dimethylpyrrolidine;hydroiodide is CC1(C)CCNC1.I.
What is the InChIKey of 3,3-dimethylpyrrolidine;hydroiodide?
The InChIKey is AHVGGTZSILSNBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.HI/c1-6(2)3-4-7-5-6;/h7H,3-5H2,1-2H3;1H.
What are the key properties of 3,3-dimethylpyrrolidine;hydroiodide?
3,3-dimethylpyrrolidine;hydroiodide has a molecular weight of 227.09 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpyrrolidine;hydroiodide is sourced from PubChem (CID 173023387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).