C11H23NO — CID 166077953
cyclobutanol;3,3-dimethylpiperidine (PubChem CID 166077953) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is cyclobutanol;3,3-dimethylpiperidine.
| Compound Name | cyclobutanol;3,3-dimethylpiperidine |
|---|---|
| PubChem CID | 166077953 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | cyclobutanol;3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCNC1.OC1CCC1 |
| InChI | InChI=1S/C7H15N.C4H8O/c1-7(2)4-3-5-8-6-7;5-4-2-1-3-4/h8H,3-6H2,1-2H3;4-5H,1-3H2 |
| InChIKey | PZAWXTLZNRXNPW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |