About 3,3-dimethylazocane;methane
3,3-dimethylazocane;methane (PubChem CID 144639099) has the molecular formula C10H23N
and a molecular weight of 157.30 g/mol. Its IUPAC name is 3,3-dimethylazocane;methane.
Molecular Properties
| Compound Name | 3,3-dimethylazocane;methane |
| PubChem CID | 144639099 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | 3,3-dimethylazocane;methane |
| SMILES | C.CC1(C)CCCCCNC1 |
| InChI | InChI=1S/C9H19N.CH4/c1-9(2)6-4-3-5-7-10-8-9;/h10H,3-8H2,1-2H3;1H4 |
| InChIKey | KSKFFXBXYZEZPJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethylazocane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylazocane;methane?
The IUPAC name of 3,3-dimethylazocane;methane (CID 144639099) is 3,3-dimethylazocane;methane.
What is the SMILES notation for 3,3-dimethylazocane;methane?
The canonical SMILES for 3,3-dimethylazocane;methane is C.CC1(C)CCCCCNC1.
What is the InChIKey of 3,3-dimethylazocane;methane?
The InChIKey is KSKFFXBXYZEZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.CH4/c1-9(2)6-4-3-5-7-10-8-9;/h10H,3-8H2,1-2H3;1H4.
What are the key properties of 3,3-dimethylazocane;methane?
3,3-dimethylazocane;methane has a molecular weight of 157.30 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylazocane;methane is sourced from PubChem (CID 144639099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).