About 2,2-dimethylazocane
2,2-dimethylazocane (PubChem CID 123664425) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 2,2-dimethylazocane.
Molecular Properties
| Compound Name | 2,2-dimethylazocane |
| PubChem CID | 123664425 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 2,2-dimethylazocane |
| SMILES | CC1(C)CCCCCCN1 |
| InChI | InChI=1S/C9H19N/c1-9(2)7-5-3-4-6-8-10-9/h10H,3-8H2,1-2H3 |
| InChIKey | XTDOVUBCMWQDKO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylazocane?
The IUPAC name of 2,2-dimethylazocane (CID 123664425) is 2,2-dimethylazocane.
What is the SMILES notation for 2,2-dimethylazocane?
The canonical SMILES for 2,2-dimethylazocane is CC1(C)CCCCCCN1.
What is the InChIKey of 2,2-dimethylazocane?
The InChIKey is XTDOVUBCMWQDKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-9(2)7-5-3-4-6-8-10-9/h10H,3-8H2,1-2H3.
What are the key properties of 2,2-dimethylazocane?
2,2-dimethylazocane has a molecular weight of 141.26 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylazocane is sourced from PubChem (CID 123664425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).