About spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid
spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid (PubChem CID 127020148) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid.
Analyze spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid?
The IUPAC name of spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid (CID 127020148) is spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid.
What is the SMILES notation for spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid?
The canonical SMILES for spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid is O=C(O)C1CNCC12CC1CCC2CC1.
What is the InChIKey of spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid?
The InChIKey is CXOQEQMXIWITDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c14-11(15)10-6-13-7-12(10)5-8-1-3-9(12)4-2-8/h8-10,13H,1-7H2,(H,14,15).
What are the key properties of spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid?
spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid has a molecular weight of 209.29 g/mol, XLogP of 1.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[2.2.2]octane-2,4'-pyrrolidine]-3'-carboxylic acid is sourced from PubChem (CID 127020148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).