C18H23Br — CID 18293472
(2S,3R,7R,11R,12R,13S)-9-bromoheptacyclo[7.7.1.13,15.01,12.02,7.04,13.06,11]octadecane (PubChem CID 18293472) has the molecular formula C18H23Br and a molecular weight of 319.29 g/mol. Its IUPAC name is (2S,3R,7R,11R,12R,13S)-9-bromoheptacyclo[7.7.1.13,15.01,12.02,7.04,13.06,11]octadecane.
| Compound Name | (2S,3R,7R,11R,12R,13S)-9-bromoheptacyclo[7.7.1.13,15.01,12.02,7.04,13.06,11]octadecane |
|---|---|
| PubChem CID | 18293472 |
| Molecular Formula | C18H23Br |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | (2S,3R,7R,11R,12R,13S)-9-bromoheptacyclo[7.7.1.13,15.01,12.02,7.04,13.06,11]octadecane |
| SMILES | BrC12C[C@@H]3C4CC5[C@H]6CC7C[C@@H]5[C@H]([C@@H]4C1)C(C7)(C2)[C@H]36 |
| InChI | InChI=1S/C18H23Br/c19-17-5-13-10-3-9-11-1-8-2-12(9)16(14(10)6-17)18(4-8,7-17)15(11)13/h8-16H,1-7H2/t8?,9?,10?,11-,12+,13-,14-,15+,16-,17?,18?/m1/s1 |
| InChIKey | BRWZCHDLVHFKDP-SPPGCOPZSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|