C61H89Br3 — CID 157458971
1,3-bis(1-adamantyl)adamantane;1,3-dibromo-5-[3-(3-bromo-1-adamantyl)-1-adamantyl]adamantane;methane (PubChem CID 157458971) has the molecular formula C61H89Br3 and a molecular weight of 1062.09 g/mol. Its IUPAC name is 1,3-bis(1-adamantyl)adamantane;1,3-dibromo-5-[3-(3-bromo-1-adamantyl)-1-adamantyl]adamantane;methane.
| Compound Name | 1,3-bis(1-adamantyl)adamantane;1,3-dibromo-5-[3-(3-bromo-1-adamantyl)-1-adamantyl]adamantane;methane |
|---|---|
| PubChem CID | 157458971 |
| Molecular Formula | C61H89Br3 |
| Molecular Weight | 1062.09 g/mol |
| Exact Mass | 1058.45 |
| IUPAC Name | 1,3-bis(1-adamantyl)adamantane;1,3-dibromo-5-[3-(3-bromo-1-adamantyl)-1-adamantyl]adamantane;methane |
| SMILES | BrC12CC3CC(C1)CC(C14CC5CC(C1)CC(C16CC7CC(Br)(CC(Br)(C7)C1)C6)(C5)C4)(C3)C2.C.C1C2CC3CC1CC(C14CC5CC(C1)CC(C16CC7CC(CC(C7)C1)C6)(C5)C4)(C2)C3 |
| InChI | InChI=1S/C30H41Br3.C30H44.CH4/c31-28-10-21-2-22(11-28)8-26(7-21,15-28)24-3-19-1-20(4-24)6-25(5-19,14-24)27-9-23-12-29(32,16-27)18-30(33,13-23)17-27;1-19-2-21-3-20(1)9-27(8-19,10-21)29-14-25-7-26(15-29)17-30(16-25,18-29)28-11-22-4-23(12-28)6-24(5-22)13-28;/h19-23H,1-18H2;19-26H,1-18H2;1H4 |
| InChIKey | BTRUDPIQYQFUEO-UHFFFAOYSA-N |
| XLogP | 18.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1062.09 |
| LogP ≤ 5 | 18.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|