C20H26Br4 — CID 15650121
1,3-dibromo-5-(3,5-dibromo-1-adamantyl)adamantane (PubChem CID 15650121) has the molecular formula C20H26Br4 and a molecular weight of 586.04 g/mol. Its IUPAC name is 1,3-dibromo-5-(3,5-dibromo-1-adamantyl)adamantane.
| Compound Name | 1,3-dibromo-5-(3,5-dibromo-1-adamantyl)adamantane |
|---|---|
| PubChem CID | 15650121 |
| Molecular Formula | C20H26Br4 |
| Molecular Weight | 586.04 g/mol |
| Exact Mass | 581.88 |
| IUPAC Name | 1,3-dibromo-5-(3,5-dibromo-1-adamantyl)adamantane |
| SMILES | BrC12CC3CC(Br)(C1)CC(C14CC5CC(Br)(CC(Br)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C20H26Br4/c21-17-3-13-1-15(7-17,8-18(22,4-13)11-17)16-2-14-5-19(23,9-16)12-20(24,6-14)10-16/h13-14H,1-12H2 |
| InChIKey | GEINHROHAQATKC-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.04 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|