About 1-bromo-3,5-di(propan-2-yl)adamantane
1-bromo-3,5-di(propan-2-yl)adamantane (PubChem CID 22763947) has the molecular formula C16H27Br
and a molecular weight of 299.30 g/mol. Its IUPAC name is 1-bromo-3,5-di(propan-2-yl)adamantane.
Molecular Properties
| Compound Name | 1-bromo-3,5-di(propan-2-yl)adamantane |
| PubChem CID | 22763947 |
| Molecular Formula | C16H27Br |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-bromo-3,5-di(propan-2-yl)adamantane |
| SMILES | CC(C)C12CC3CC(Br)(C1)CC(C(C)C)(C3)C2 |
| InChI | InChI=1S/C16H27Br/c1-11(2)14-5-13-6-15(8-14,12(3)4)10-16(17,7-13)9-14/h11-13H,5-10H2,1-4H3 |
| InChIKey | VHOBEWBLBNUWEL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,5-di(propan-2-yl)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-di(propan-2-yl)adamantane?
The IUPAC name of 1-bromo-3,5-di(propan-2-yl)adamantane (CID 22763947) is 1-bromo-3,5-di(propan-2-yl)adamantane.
What is the SMILES notation for 1-bromo-3,5-di(propan-2-yl)adamantane?
The canonical SMILES for 1-bromo-3,5-di(propan-2-yl)adamantane is CC(C)C12CC3CC(Br)(C1)CC(C(C)C)(C3)C2.
What is the InChIKey of 1-bromo-3,5-di(propan-2-yl)adamantane?
The InChIKey is VHOBEWBLBNUWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27Br/c1-11(2)14-5-13-6-15(8-14,12(3)4)10-16(17,7-13)9-14/h11-13H,5-10H2,1-4H3.
What are the key properties of 1-bromo-3,5-di(propan-2-yl)adamantane?
1-bromo-3,5-di(propan-2-yl)adamantane has a molecular weight of 299.30 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-di(propan-2-yl)adamantane is sourced from PubChem (CID 22763947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).