About (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile
(1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile (PubChem CID 122366857) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile.
Analyze (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile?
The IUPAC name of (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile (CID 122366857) is (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile.
What is the SMILES notation for (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile?
The canonical SMILES for (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile is N#CC12CC3C[C@]4(C1)C[C@@]4(C3)C2.
What is the InChIKey of (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile?
The InChIKey is KTXBGPGYWQAZAS-HWACXVBKSA-N. The full InChI is InChI=1S/C11H13N/c12-7-9-1-8-2-10(4-9)6-11(10,3-8)5-9/h8H,1-6H2/t8?,9?,10-,11+.
What are the key properties of (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile?
(1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile has a molecular weight of 159.23 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,3R)-tetracyclo[3.3.1.13,7.01,3]decane-5-carbonitrile is sourced from PubChem (CID 122366857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).