C17H23NO2 — CID 66766619
(3-cyano-5-methyl-1-adamantyl)methyl 2-methylprop-2-enoate (PubChem CID 66766619) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (3-cyano-5-methyl-1-adamantyl)methyl 2-methylprop-2-enoate.
| Compound Name | (3-cyano-5-methyl-1-adamantyl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66766619 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (3-cyano-5-methyl-1-adamantyl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC12CC3CC(C)(CC(C#N)(C3)C1)C2 |
| InChI | InChI=1S/C17H23NO2/c1-12(2)14(19)20-11-17-6-13-4-15(3,8-17)7-16(5-13,9-17)10-18/h13H,1,4-9,11H2,2-3H3 |
| InChIKey | YABBZHDMKTVEKV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|