C17H20N2O2 — CID 66766618
(3,5-dicyano-7-methyl-1-adamantyl) 2-methylprop-2-enoate (PubChem CID 66766618) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is (3,5-dicyano-7-methyl-1-adamantyl) 2-methylprop-2-enoate.
| Compound Name | (3,5-dicyano-7-methyl-1-adamantyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66766618 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | (3,5-dicyano-7-methyl-1-adamantyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3(C)CC(C#N)(CC(C#N)(C3)C1)C2 |
| InChI | InChI=1S/C17H20N2O2/c1-12(2)13(20)21-17-6-14(3)4-15(8-17,10-18)7-16(5-14,9-17)11-19/h1,4-9H2,2-3H3 |
| InChIKey | RMONFXXOYBVMKW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|