C18H24O6 — CID 141224107
3-methoxycarbonyl-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid (PubChem CID 141224107) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is 3-methoxycarbonyl-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid.
| Compound Name | 3-methoxycarbonyl-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid |
|---|---|
| PubChem CID | 141224107 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-methoxycarbonyl-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylic acid |
| SMILES | C=C(C)C(=O)OC12CC3(C)CC(C(=O)O)(C1)CC(C(=O)OC)(C3)C2 |
| InChI | InChI=1S/C18H24O6/c1-11(2)12(19)24-18-7-15(3)5-16(9-18,13(20)21)8-17(6-15,10-18)14(22)23-4/h1,5-10H2,2-4H3,(H,20,21) |
| InChIKey | PCXRUWCRFADBEB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|