C19H28O5 — CID 66766601
methyl 3-(methoxymethyl)-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 66766601) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is methyl 3-(methoxymethyl)-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | methyl 3-(methoxymethyl)-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 66766601 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | methyl 3-(methoxymethyl)-5-methyl-7-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3(C)CC(COC)(C1)CC(C(=O)OC)(C3)C2 |
| InChI | InChI=1S/C19H28O5/c1-13(2)14(20)24-19-8-16(3)6-17(10-19,12-22-4)9-18(7-16,11-19)15(21)23-5/h1,6-12H2,2-5H3 |
| InChIKey | PFSKDDRIHBFNMJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|