C19H26O6 — CID 141091731
dimethyl 5-methyl-7-(prop-2-enoyloxymethyl)adamantane-1,3-dicarboxylate (PubChem CID 141091731) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is dimethyl 5-methyl-7-(prop-2-enoyloxymethyl)adamantane-1,3-dicarboxylate.
| Compound Name | dimethyl 5-methyl-7-(prop-2-enoyloxymethyl)adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 141091731 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | dimethyl 5-methyl-7-(prop-2-enoyloxymethyl)adamantane-1,3-dicarboxylate |
| SMILES | C=CC(=O)OCC12CC3(C)CC(C(=O)OC)(C1)CC(C(=O)OC)(C3)C2 |
| InChI | InChI=1S/C19H26O6/c1-5-13(20)25-12-17-6-16(2)7-18(9-17,14(21)23-3)11-19(8-16,10-17)15(22)24-4/h5H,1,6-12H2,2-4H3 |
| InChIKey | PQSYXDIHJJTDIQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|