C13H18O4 — CID 59609109
(1-ethyl-2,2-dimethyl-4,5-dioxocyclopentyl)methyl prop-2-enoate (PubChem CID 59609109) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1-ethyl-2,2-dimethyl-4,5-dioxocyclopentyl)methyl prop-2-enoate.
| Compound Name | (1-ethyl-2,2-dimethyl-4,5-dioxocyclopentyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 59609109 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1-ethyl-2,2-dimethyl-4,5-dioxocyclopentyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(CC)C(=O)C(=O)CC1(C)C |
| InChI | InChI=1S/C13H18O4/c1-5-10(15)17-8-13(6-2)11(16)9(14)7-12(13,3)4/h5H,1,6-8H2,2-4H3 |
| InChIKey | RZOXPRZSVHYUOA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|