C9H13NO4 — CID 11252619
(4-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl prop-2-enoate (PubChem CID 11252619) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (4-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl prop-2-enoate.
| Compound Name | (4-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 11252619 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (4-ethyl-2-oxo-1,3-oxazolidin-4-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(CC)COC(=O)N1 |
| InChI | InChI=1S/C9H13NO4/c1-3-7(11)13-5-9(4-2)6-14-8(12)10-9/h3H,1,4-6H2,2H3,(H,10,12) |
| InChIKey | GNMCBCWJPIVMQR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|