C15H19BO4 — CID 153107264
(5-ethyl-2-phenyl-1,3,2-dioxaborinan-5-yl)methyl prop-2-enoate (PubChem CID 153107264) has the molecular formula C15H19BO4 and a molecular weight of 274.13 g/mol. Its IUPAC name is (5-ethyl-2-phenyl-1,3,2-dioxaborinan-5-yl)methyl prop-2-enoate.
| Compound Name | (5-ethyl-2-phenyl-1,3,2-dioxaborinan-5-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 153107264 |
| Molecular Formula | C15H19BO4 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (5-ethyl-2-phenyl-1,3,2-dioxaborinan-5-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(CC)COB(c2ccccc2)OC1 |
| InChI | InChI=1S/C15H19BO4/c1-3-14(17)18-10-15(4-2)11-19-16(20-12-15)13-8-6-5-7-9-13/h3,5-9H,1,4,10-12H2,2H3 |
| InChIKey | VSFQEOKMZQTBPY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|