C9H10O5 — CID 70213115
(4-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate (PubChem CID 70213115) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is (4-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate.
| Compound Name | (4-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 70213115 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (4-ethenyl-2-oxo-1,3-dioxolan-4-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1(C=C)COC(=O)O1 |
| InChI | InChI=1S/C9H10O5/c1-3-7(10)12-5-9(4-2)6-13-8(11)14-9/h3-4H,1-2,5-6H2 |
| InChIKey | VHKPQCDWNLJLOF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|