C12H17NO6 — CID 166063146
(5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl N-methyl-N-prop-2-enoylcarbamate (PubChem CID 166063146) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is (5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl N-methyl-N-prop-2-enoylcarbamate.
| Compound Name | (5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl N-methyl-N-prop-2-enoylcarbamate |
|---|---|
| PubChem CID | 166063146 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (5-ethyl-2-oxo-1,3-dioxan-5-yl)methyl N-methyl-N-prop-2-enoylcarbamate |
| SMILES | C=CC(=O)N(C)C(=O)OCC1(CC)COC(=O)OC1 |
| InChI | InChI=1S/C12H17NO6/c1-4-9(14)13(3)10(15)17-6-12(5-2)7-18-11(16)19-8-12/h4H,1,5-8H2,2-3H3 |
| InChIKey | KQJWMNAMDYSBGK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|