C10H14O3 — CID 54525893
5,5-bis(prop-2-enyl)-1,3-dioxan-2-one (PubChem CID 54525893) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 5,5-bis(prop-2-enyl)-1,3-dioxan-2-one.
| Compound Name | 5,5-bis(prop-2-enyl)-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 54525893 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5,5-bis(prop-2-enyl)-1,3-dioxan-2-one |
| SMILES | C=CCC1(CC=C)COC(=O)OC1 |
| InChI | InChI=1S/C10H14O3/c1-3-5-10(6-4-2)7-12-9(11)13-8-10/h3-4H,1-2,5-8H2 |
| InChIKey | KLKVHTMBFOGYLF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|