C9H12O3 — CID 14636614
3,5-dimethyl-3-prop-2-enyloxolane-2,4-dione (PubChem CID 14636614) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,5-dimethyl-3-prop-2-enyloxolane-2,4-dione.
| Compound Name | 3,5-dimethyl-3-prop-2-enyloxolane-2,4-dione |
|---|---|
| PubChem CID | 14636614 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3,5-dimethyl-3-prop-2-enyloxolane-2,4-dione |
| SMILES | C=CCC1(C)C(=O)OC(C)C1=O |
| InChI | InChI=1S/C9H12O3/c1-4-5-9(3)7(10)6(2)12-8(9)11/h4,6H,1,5H2,2-3H3 |
| InChIKey | LMMSIMSMHJMPTC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|