C20H32O — CID 9437167
(1S,4aR,8aS)-1,4a,7,7-tetramethyl-3,3-bis(prop-2-enyl)-1,4,5,6,8,8a-hexahydronaphthalen-2-one (PubChem CID 9437167) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is (1S,4aR,8aS)-1,4a,7,7-tetramethyl-3,3-bis(prop-2-enyl)-1,4,5,6,8,8a-hexahydronaphthalen-2-one.
| Compound Name | (1S,4aR,8aS)-1,4a,7,7-tetramethyl-3,3-bis(prop-2-enyl)-1,4,5,6,8,8a-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 9437167 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,4aR,8aS)-1,4a,7,7-tetramethyl-3,3-bis(prop-2-enyl)-1,4,5,6,8,8a-hexahydronaphthalen-2-one |
| SMILES | C=CCC1(CC=C)C[C@@]2(C)CCC(C)(C)C[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C20H32O/c1-7-9-20(10-8-2)14-19(6)12-11-18(4,5)13-16(19)15(3)17(20)21/h7-8,15-16H,1-2,9-14H2,3-6H3/t15-,16-,19+/m0/s1 |
| InChIKey | WEDYCCULTFMMDI-TXPKVOOTSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|