C16H24O — CID 10489766
(1aR,3aS,6aS,6bR)-5,5,6b-trimethyl-1a-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-2-one (PubChem CID 10489766) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (1aR,3aS,6aS,6bR)-5,5,6b-trimethyl-1a-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-2-one.
| Compound Name | (1aR,3aS,6aS,6bR)-5,5,6b-trimethyl-1a-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-2-one |
|---|---|
| PubChem CID | 10489766 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (1aR,3aS,6aS,6bR)-5,5,6b-trimethyl-1a-prop-2-enyl-1,3,3a,4,6,6a-hexahydrocyclopropa[e]inden-2-one |
| SMILES | C=CC[C@@]12C[C@]1(C)[C@H]1CC(C)(C)C[C@H]1CC2=O |
| InChI | InChI=1S/C16H24O/c1-5-6-16-10-15(16,4)12-9-14(2,3)8-11(12)7-13(16)17/h5,11-12H,1,6-10H2,2-4H3/t11-,12+,15-,16+/m1/s1 |
| InChIKey | VSLXYLDWWANQJB-KOZAUXTDSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|