C18H28O6 — CID 139783066
[5-ethyl-2-(2-methyl-1-prop-2-enoyloxypropan-2-yl)-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate (PubChem CID 139783066) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is [5-ethyl-2-(2-methyl-1-prop-2-enoyloxypropan-2-yl)-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [5-ethyl-2-(2-methyl-1-prop-2-enoyloxypropan-2-yl)-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139783066 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [5-ethyl-2-(2-methyl-1-prop-2-enoyloxypropan-2-yl)-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(C)C1OCC(CC)(COC(=O)C(=C)C)CO1 |
| InChI | InChI=1S/C18H28O6/c1-7-14(19)21-9-17(5,6)16-23-11-18(8-2,12-24-16)10-22-15(20)13(3)4/h7,16H,1,3,8-12H2,2,4-6H3 |
| InChIKey | UEBPATNAVCJGPH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|