C17H28O5 — CID 23534044
[5-ethyl-2-(2-methyl-4-oxohex-5-en-2-yl)-1,3-dioxan-5-yl]methyl propanoate (PubChem CID 23534044) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is [5-ethyl-2-(2-methyl-4-oxohex-5-en-2-yl)-1,3-dioxan-5-yl]methyl propanoate.
| Compound Name | [5-ethyl-2-(2-methyl-4-oxohex-5-en-2-yl)-1,3-dioxan-5-yl]methyl propanoate |
|---|---|
| PubChem CID | 23534044 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | [5-ethyl-2-(2-methyl-4-oxohex-5-en-2-yl)-1,3-dioxan-5-yl]methyl propanoate |
| SMILES | C=CC(=O)CC(C)(C)C1OCC(CC)(COC(=O)CC)CO1 |
| InChI | InChI=1S/C17H28O5/c1-6-13(18)9-16(4,5)15-21-11-17(8-3,12-22-15)10-20-14(19)7-2/h6,15H,1,7-12H2,2-5H3 |
| InChIKey | XSKRDRDFFPOBIX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|