C17H28O6 — CID 166701882
[2-[5-ethyl-5-(1-hydroxyprop-2-enoxymethyl)-1,3-dioxan-2-yl]-2-methylpropyl] prop-2-enoate (PubChem CID 166701882) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is [2-[5-ethyl-5-(1-hydroxyprop-2-enoxymethyl)-1,3-dioxan-2-yl]-2-methylpropyl] prop-2-enoate.
| Compound Name | [2-[5-ethyl-5-(1-hydroxyprop-2-enoxymethyl)-1,3-dioxan-2-yl]-2-methylpropyl] prop-2-enoate |
|---|---|
| PubChem CID | 166701882 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | [2-[5-ethyl-5-(1-hydroxyprop-2-enoxymethyl)-1,3-dioxan-2-yl]-2-methylpropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(C)C1OCC(CC)(COC(O)C=C)CO1 |
| InChI | InChI=1S/C17H28O6/c1-6-13(18)20-9-16(4,5)15-22-11-17(8-3,12-23-15)10-21-14(19)7-2/h6-7,14-15,19H,1-2,8-12H2,3-5H3 |
| InChIKey | YEAGULFTCZIAMV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|