C26H36O8 — CID 70192127
bis[2-(2-methylprop-2-enoyloxy)ethyl] 5,7-dimethyladamantane-1,3-dicarboxylate (PubChem CID 70192127) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is bis[2-(2-methylprop-2-enoyloxy)ethyl] 5,7-dimethyladamantane-1,3-dicarboxylate.
| Compound Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] 5,7-dimethyladamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70192127 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] 5,7-dimethyladamantane-1,3-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C12CC3(C)CC(C)(C1)CC(C(=O)OCCOC(=O)C(=C)C)(C3)C2 |
| InChI | InChI=1S/C26H36O8/c1-17(2)19(27)31-7-9-33-21(29)25-12-23(5)11-24(6,13-25)15-26(14-23,16-25)22(30)34-10-8-32-20(28)18(3)4/h1,3,7-16H2,2,4-6H3 |
| InChIKey | NAODIOPFYBHGDJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|