C16H20O6 — CID 175603285
5-(3-methoxy-3-oxoprop-1-en-2-yl)adamantane-1,3-dicarboxylic acid (PubChem CID 175603285) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-(3-methoxy-3-oxoprop-1-en-2-yl)adamantane-1,3-dicarboxylic acid.
| Compound Name | 5-(3-methoxy-3-oxoprop-1-en-2-yl)adamantane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175603285 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-(3-methoxy-3-oxoprop-1-en-2-yl)adamantane-1,3-dicarboxylic acid |
| SMILES | C=C(C(=O)OC)C12CC3CC(C(=O)O)(C1)CC(C(=O)O)(C3)C2 |
| InChI | InChI=1S/C16H20O6/c1-9(11(17)22-2)14-3-10-4-15(6-14,12(18)19)8-16(5-10,7-14)13(20)21/h10H,1,3-8H2,2H3,(H,18,19)(H,20,21) |
| InChIKey | KTSWJZSQCUBAGN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|